CAS 874511-41-8 appears in our catalog under these names: 6-Nitrothiazolo(4,5-b)pyridin-2-amine, 95+%, 6-Nitro-(1,3)thiazolo(4,5-b)pyridin-2-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
6-nitro-[1,3]thiazolo[4,5-b]pyridin-2-amine (CAS 874511-41-8) is a chemical compound with the molecular formula C6H4N4O2S and a molecular weight of 196.19 g/mol. IUPAC name: 6-nitro-[1,3]thiazolo[4,5-b]pyridin-2-amine. InChIKey: BNIUQTPBTCPKEQ-UHFFFAOYSA-N.
| Molecular formula | C6H4N4O2S |
|---|---|
| Molecular weight | 196.19 g/mol |
| IUPAC name | 6-nitro-[1,3]thiazolo[4,5-b]pyridin-2-amine |
| InChIKey | BNIUQTPBTCPKEQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1SC(=N2)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)