cas: 2586-99-4 — see every product listed under this CAS number, including other names
5-Nitropyridine-2,4-diamine 95% (CAS 2586-99-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A208233-100mg |
| cas | 2586-99-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 253.56 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 921.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A208233 |
5-nitropyridine-2,4-diamine (CAS 2586-99-4) is a chemical compound with the molecular formula C5H6N4O2 and a molecular weight of 154.13 g/mol. IUPAC name: 5-nitropyridine-2,4-diamine. InChIKey: SXBHXFMYNOLWEC-UHFFFAOYSA-N.
| Molecular formula | C5H6N4O2 |
|---|---|
| Molecular weight | 154.13 g/mol |
| IUPAC name | 5-nitropyridine-2,4-diamine |
| InChIKey | SXBHXFMYNOLWEC-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1N)[N+](=O)[O-])N |
Computed by PubChem (NCBI)