cas: 78189-50-1 — see every product listed under this CAS number, including other names
5-Phenylisoxazole-3-carbonyl chloride, 95+% (CAS 78189-50-1) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A596044-10g |
| cas | 78189-50-1 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 13526.17 Pln | |
| AmBeed | 5g | 9717.82 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-phenyl-1,2-oxazole-3-carbonyl chloride (CAS 78189-50-1) is a chemical compound with the molecular formula C10H6ClNO2 and a molecular weight of 207.61 g/mol. IUPAC name: 5-phenyl-1,2-oxazole-3-carbonyl chloride. InChIKey: FUQOIZJIDZZDGY-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNO2 |
|---|---|
| Molecular weight | 207.61 g/mol |
| IUPAC name | 5-phenyl-1,2-oxazole-3-carbonyl chloride |
| InChIKey | FUQOIZJIDZZDGY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=NO2)C(=O)Cl |
Computed by PubChem (NCBI)