cas: 1201187-46-3 — see every product listed under this CAS number, including other names
5-Tosyl-5H-pyrrolo[2,3-b]pyrazin-2-amine, 97%, 97% (CAS 1201187-46-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DF86-100mg |
| cas | 1201187-46-3 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 400.40 Pln | |
| Chemat | 500mg | 1427.60 Pln | |
| Chemat | 1g | 2594.00 Pln | |
| Chemat | 5g | 8930.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazin-2-amine (CAS 1201187-46-3) is a chemical compound with the molecular formula C13H12N4O2S and a molecular weight of 288.33 g/mol. IUPAC name: 5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazin-2-amine. InChIKey: JICQDRBUYWXGIQ-UHFFFAOYSA-N.
| Molecular formula | C13H12N4O2S |
|---|---|
| Molecular weight | 288.33 g/mol |
| IUPAC name | 5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazin-2-amine |
| InChIKey | JICQDRBUYWXGIQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C=CC3=NC(=CN=C32)N |
Computed by PubChem (NCBI)