CAS 2173107-06-5 appears in our catalog under these names: 7-[(4-Methylbenzene)sulfonyl]pyrrolo[2,3-d]pyrimidin-4-amine, 96%, 7-Tosyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 250mg, 100mg.
7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidin-4-amine (CAS 2173107-06-5) is a chemical compound with the molecular formula C13H12N4O2S and a molecular weight of 288.33 g/mol. IUPAC name: 7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidin-4-amine. InChIKey: OIQONGZISGHCTC-UHFFFAOYSA-N.
| Molecular formula | C13H12N4O2S |
|---|---|
| Molecular weight | 288.33 g/mol |
| IUPAC name | 7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidin-4-amine |
| InChIKey | OIQONGZISGHCTC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C=CC3=C(N=CN=C32)N |
Computed by PubChem (NCBI)