cas: 1240602-39-4 — see every product listed under this CAS number, including other names
5-bromo-2-methyl-6-(trifluoromethyl)-3,4-dihydropyrimidin-4-one, 95% (CAS 1240602-39-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F689703-100MG |
| cas | 1240602-39-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 445.69 Pln | |
| Fluorochem | 250mg | 737.26 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
5-bromo-2-methyl-4-(trifluoromethyl)-1H-pyrimidin-6-one (CAS 1240602-39-4) is a chemical compound with the molecular formula C6H4BrF3N2O and a molecular weight of 257.01 g/mol. IUPAC name: 5-bromo-2-methyl-4-(trifluoromethyl)-1H-pyrimidin-6-one. InChIKey: OKPVWODKHJZUGG-UHFFFAOYSA-N.
| Molecular formula | C6H4BrF3N2O |
|---|---|
| Molecular weight | 257.01 g/mol |
| IUPAC name | 5-bromo-2-methyl-4-(trifluoromethyl)-1H-pyrimidin-6-one |
| InChIKey | OKPVWODKHJZUGG-UHFFFAOYSA-N |
| SMILES | CC1=NC(=C(C(=O)N1)Br)C(F)(F)F |
Computed by PubChem (NCBI)