cas: 845305-86-4 — see every product listed under this CAS number, including other names
5-bromo-N,N-dimethylpicolinamide, 97%, 97% (CAS 845305-86-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119HVG-250mg |
| cas | 845305-86-4 |
| size | 250mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 232.40 Pln | |
| Chemat | 1g | 515.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-bromo-N,N-dimethylpyridine-2-carboxamide (CAS 845305-86-4) is a chemical compound with the molecular formula C8H9BrN2O and a molecular weight of 229.07 g/mol. IUPAC name: 5-bromo-N,N-dimethylpyridine-2-carboxamide. InChIKey: KQRHFAPOFNDZHY-UHFFFAOYSA-N.
| Molecular formula | C8H9BrN2O |
|---|---|
| Molecular weight | 229.07 g/mol |
| IUPAC name | 5-bromo-N,N-dimethylpyridine-2-carboxamide |
| InChIKey | KQRHFAPOFNDZHY-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=NC=C(C=C1)Br |
Computed by PubChem (NCBI)