cas: 100907-37-7 — see every product listed under this CAS number, including other names
5-butyl-2-phenylpyridine, 95%, 95% (CAS 100907-37-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11147D-100mg |
| cas | 100907-37-7 |
| size | 100mg |
| availability | 0.85g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 750.80 Pln | |
| Chemat | 250mg | 1442.00 Pln | |
| Chemat | 500mg | 2680.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-butyl-2-phenylpyridine (CAS 100907-37-7) is a chemical compound with the molecular formula C15H17N and a molecular weight of 211.30 g/mol. IUPAC name: 5-butyl-2-phenylpyridine. InChIKey: NHAVSAOASSCFES-UHFFFAOYSA-N.
| Molecular formula | C15H17N |
|---|---|
| Molecular weight | 211.30 g/mol |
| IUPAC name | 5-butyl-2-phenylpyridine |
| InChIKey | NHAVSAOASSCFES-UHFFFAOYSA-N |
| SMILES | CCCCC1=CN=C(C=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)