cas: 1022931-73-2 — see every product listed under this CAS number, including other names
5-tert-Butoxycarbonyl-3-(trifluoromethyl)-4,5,6,7-tetrahydro-1H-pyrazolo[4,3-c]pyridine, 98%, 98% (CAS 1022931-73-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11185R-100mg |
| cas | 1022931-73-2 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 203.60 Pln | |
| Chemat | 250mg | 275.60 Pln | |
| Chemat | 1g | 909.20 Pln | |
| Chemat | 5g | 3035.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3-(trifluoromethyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-5-carboxylate (CAS 1022931-73-2) is a chemical compound with the molecular formula C12H16F3N3O2 and a molecular weight of 291.27 g/mol. IUPAC name: tert-butyl 3-(trifluoromethyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-5-carboxylate. InChIKey: MQTQWJKOXQOZDC-UHFFFAOYSA-N.
| Molecular formula | C12H16F3N3O2 |
|---|---|
| Molecular weight | 291.27 g/mol |
| IUPAC name | tert-butyl 3-(trifluoromethyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-5-carboxylate |
| InChIKey | MQTQWJKOXQOZDC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(C1)C(=NN2)C(F)(F)F |
Computed by PubChem (NCBI)