tert-Butyl 3-(trifluoromethyl)-6,7-dihydro-1H-pyrazolo[4,3-c]pyridine-5(4H)-carboxylate 98%
cas: 1022931-73-2 — see every product listed under this CAS number, including other names
tert-Butyl 3-(trifluoromethyl)-6,7-dihydro-1H-pyrazolo[4,3-c]pyridine-5(4H)-carboxylate 98% (CAS 1022931-73-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A681812-100mg |
| cas | 1022931-73-2 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 275.81 Pln | |
| Ambeed | 250mg | 325.88 Pln | |
| Ambeed | 1g | 592.88 Pln | |
| Ambeed | 5g | 1744.31 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A681812 |
Tert-butyl 3-(trifluoromethyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-5-carboxylate (CAS 1022931-73-2) is a chemical compound with the molecular formula C12H16F3N3O2 and a molecular weight of 291.27 g/mol. IUPAC name: tert-butyl 3-(trifluoromethyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-5-carboxylate. InChIKey: MQTQWJKOXQOZDC-UHFFFAOYSA-N.
| Molecular formula | C12H16F3N3O2 |
|---|---|
| Molecular weight | 291.27 g/mol |
| IUPAC name | tert-butyl 3-(trifluoromethyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-5-carboxylate |
| InChIKey | MQTQWJKOXQOZDC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(C1)C(=NN2)C(F)(F)F |
Computed by PubChem (NCBI)