cas: 398495-65-3 — see every product listed under this CAS number, including other names
5-tert-Butyl 1-ethyl 3-aminopyrrolo[3,4-c]pyrazole-1,5(4H,6H)-dicarboxylate 95% (CAS 398495-65-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A193972-250mg |
| cas | 398495-65-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 209.06 Pln | |
| Ambeed | 1g | 437.12 Pln | |
| Ambeed | 5g | 1538.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A193972 |
5-O-tert-butyl 1-O-ethyl 3-amino-4,6-dihydropyrrolo[3,4-d]pyrazole-1,5-dicarboxylate (CAS 398495-65-3) is a chemical compound with the molecular formula C13H20N4O4 and a molecular weight of 296.32 g/mol. IUPAC name: 5-O-tert-butyl 1-O-ethyl 3-amino-4,6-dihydropyrrolo[3,4-d]pyrazole-1,5-dicarboxylate. InChIKey: VUWAGENLXQIUJY-UHFFFAOYSA-N.
| Molecular formula | C13H20N4O4 |
|---|---|
| Molecular weight | 296.32 g/mol |
| IUPAC name | 5-O-tert-butyl 1-O-ethyl 3-amino-4,6-dihydropyrrolo[3,4-d]pyrazole-1,5-dicarboxylate |
| InChIKey | VUWAGENLXQIUJY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)N1C2=C(CN(C2)C(=O)OC(C)(C)C)C(=N1)N |
Computed by PubChem (NCBI)