cas: 398495-65-3 — see every product listed under this CAS number, including other names
1-Ethyloxycarbonyl-5-Boc-3-amino-4,6-dihydro-pyrrolo[3,4-c]pyrazole, 97% (CAS 398495-65-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F050069-1G |
| cas | 398495-65-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 409.25 Pln | |
| Fluorochem | 5g | 1575.50 Pln | |
| Fluorochem | 10g | 3095.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
5-O-tert-butyl 1-O-ethyl 3-amino-4,6-dihydropyrrolo[3,4-d]pyrazole-1,5-dicarboxylate (CAS 398495-65-3) is a chemical compound with the molecular formula C13H20N4O4 and a molecular weight of 296.32 g/mol. IUPAC name: 5-O-tert-butyl 1-O-ethyl 3-amino-4,6-dihydropyrrolo[3,4-d]pyrazole-1,5-dicarboxylate. InChIKey: VUWAGENLXQIUJY-UHFFFAOYSA-N.
| Molecular formula | C13H20N4O4 |
|---|---|
| Molecular weight | 296.32 g/mol |
| IUPAC name | 5-O-tert-butyl 1-O-ethyl 3-amino-4,6-dihydropyrrolo[3,4-d]pyrazole-1,5-dicarboxylate |
| InChIKey | VUWAGENLXQIUJY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)N1C2=C(CN(C2)C(=O)OC(C)(C)C)C(=N1)N |
Computed by PubChem (NCBI)