5H-Benzo[d]benzo[4,5]imidazo[1,2-a]imidazole, 95%
cas: 28890-99-5 — see every product listed under this CAS number, including other names
5H-Benzo[d]benzo[4,5]imidazo[1,2-a]imidazole, 95% (CAS 28890-99-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A229639-100mg |
| cas | 28890-99-5 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 231.31 Pln | |
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 676.31 Pln | |
| Ambeed | 5g | 1950.12 Pln | |
| Ambeed | 10g | 3541.00 Pln | |
| BLDpharm | 100mg | 247.72 Pln | |
| BLDpharm | 250mg | 347.68 Pln | |
| BLDpharm | 1g | 725.32 Pln | |
| BLDpharm | 5g | 2097.06 Pln | |
| BLDpharm | 10g | 3813.13 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
6H-benzimidazolo[1,2-a]benzimidazole (CAS 28890-99-5) is a chemical compound with the molecular formula C13H9N3 and a molecular weight of 207.23 g/mol. IUPAC name: 6H-benzimidazolo[1,2-a]benzimidazole. InChIKey: KLACMEYLRXQSMN-UHFFFAOYSA-N.
| Molecular formula | C13H9N3 |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | 6H-benzimidazolo[1,2-a]benzimidazole |
| InChIKey | KLACMEYLRXQSMN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC3=NC4=CC=CC=C4N23 |
Computed by PubChem (NCBI)