CAS 65037-75-4 is the registry number for 2-((1-Methyl-1H-indol-3-yl)methylidene)propanedinitrile, 95%. Offered by: AmBeed. Available pack sizes: 10g.
2-[(1-methylindol-3-yl)methylidene]propanedinitrile (CAS 65037-75-4) is a chemical compound with the molecular formula C13H9N3 and a molecular weight of 207.23 g/mol. IUPAC name: 2-[(1-methylindol-3-yl)methylidene]propanedinitrile. InChIKey: ZVHTWMGONKMROW-UHFFFAOYSA-N.
| Molecular formula | C13H9N3 |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | 2-[(1-methylindol-3-yl)methylidene]propanedinitrile |
| InChIKey | ZVHTWMGONKMROW-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=CC=CC=C21)C=C(C#N)C#N |
Computed by PubChem (NCBI)