CAS 827001-82-1 appears in our catalog under these names: 5J-4/ 96.12% (existing batch purity), 5J 4, 5J-4, 5J-4, 95%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 5 mg, 10 mg.
N-[(6-hydroxynaphthalen-1-yl)carbamothioyl]furan-2-carboxamide (CAS 827001-82-1) is a chemical compound with the molecular formula C16H12N2O3S and a molecular weight of 312.3 g/mol. IUPAC name: N-[(6-hydroxynaphthalen-1-yl)carbamothioyl]furan-2-carboxamide. InChIKey: WMUSJLJASFXGHN-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O3S |
|---|---|
| Molecular weight | 312.3 g/mol |
| IUPAC name | N-[(6-hydroxynaphthalen-1-yl)carbamothioyl]furan-2-carboxamide |
| InChIKey | WMUSJLJASFXGHN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)O)C(=C1)NC(=S)NC(=O)C3=CC=CO3 |
Computed by PubChem (NCBI)