CAS 1176721-85-9 is the registry number for 2-((4-Phenoxyphenyl)amino)-1,3-thiazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 5000mg, 10000mg.
2-(4-phenoxyanilino)-1,3-thiazole-4-carboxylic acid (CAS 1176721-85-9) is a chemical compound with the molecular formula C16H12N2O3S and a molecular weight of 312.3 g/mol. IUPAC name: 2-(4-phenoxyanilino)-1,3-thiazole-4-carboxylic acid. InChIKey: FBRSUMGTAWKAPW-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O3S |
|---|---|
| Molecular weight | 312.3 g/mol |
| IUPAC name | 2-(4-phenoxyanilino)-1,3-thiazole-4-carboxylic acid |
| InChIKey | FBRSUMGTAWKAPW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)NC3=NC(=CS3)C(=O)O |
Computed by PubChem (NCBI)