Products 1176721-85-9

CAS 1176721-85-9 is the registry number for 2-((4-Phenoxyphenyl)amino)-1,3-thiazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 5000mg, 10000mg.

Structural formula: {0} (CAS {1})

2-(4-phenoxyanilino)-1,3-thiazole-4-carboxylic acid (CAS 1176721-85-9) is a chemical compound with the molecular formula C16H12N2O3S and a molecular weight of 312.3 g/mol. IUPAC name: 2-(4-phenoxyanilino)-1,3-thiazole-4-carboxylic acid. InChIKey: FBRSUMGTAWKAPW-UHFFFAOYSA-N.

Identity
Molecular formulaC16H12N2O3S
Molecular weight312.3 g/mol
IUPAC name2-(4-phenoxyanilino)-1,3-thiazole-4-carboxylic acid
InChIKeyFBRSUMGTAWKAPW-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)OC2=CC=C(C=C2)NC3=NC(=CS3)C(=O)O

Computed by PubChem (NCBI)