cas: 2007916-11-0 — see every product listed under this CAS number, including other names
6,7-Dihydro-5H-pyrrolo(1,2-a)imidazol-7-yl tert-butylcarbamate, 97% (CAS 2007916-11-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A652454-5g |
| cas | 2007916-11-0 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 30367.54 Pln | |
| AmBeed | 1g | 10140.97 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-7-yl N-tert-butylcarbamate (CAS 2007916-11-0) is a chemical compound with the molecular formula C11H17N3O2 and a molecular weight of 223.27 g/mol. IUPAC name: 6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-7-yl N-tert-butylcarbamate. InChIKey: BBDVWGBOCRFMKY-UHFFFAOYSA-N.
| Molecular formula | C11H17N3O2 |
|---|---|
| Molecular weight | 223.27 g/mol |
| IUPAC name | 6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-7-yl N-tert-butylcarbamate |
| InChIKey | BBDVWGBOCRFMKY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NC(=O)OC1CCN2C1=NC=C2 |
Computed by PubChem (NCBI)