cas: 4118-36-9 — see every product listed under this CAS number, including other names
6,7-Dimethoxy-1-phenyl-1,2,3,4-tetrahydroisoquinoline, 98% (CAS 4118-36-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 2.5g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F049648-1G |
| cas | 4118-36-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 487.35 Pln | |
| Fluorochem | 2.5g | 1049.65 Pln | |
| Fluorochem | 5g | 1559.89 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
6,7-dimethoxy-1-phenyl-1,2,3,4-tetrahydroisoquinoline (CAS 4118-36-9) is a chemical compound with the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. IUPAC name: 6,7-dimethoxy-1-phenyl-1,2,3,4-tetrahydroisoquinoline. InChIKey: GZGZWZVAJDFXJK-UHFFFAOYSA-N.
| Molecular formula | C17H19NO2 |
|---|---|
| Molecular weight | 269.34 g/mol |
| IUPAC name | 6,7-dimethoxy-1-phenyl-1,2,3,4-tetrahydroisoquinoline |
| InChIKey | GZGZWZVAJDFXJK-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(NCCC2=C1)C3=CC=CC=C3)OC |
Computed by PubChem (NCBI)