cas: 765899-28-3 — see every product listed under this CAS number, including other names
6,7-Dimethoxy-N-(4-nitrophenyl)quinazolin-4-amine (CAS 765899-28-3) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G0UE-5mg |
| cas | 765899-28-3 |
| size | 5mg |
| availability | 0.2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5mg | 126.80 Pln | |
| Chemat | 10mg | 165.20 Pln | |
| Chemat | 25mg | 256.40 Pln | |
| Chemat | 50mg | 381.20 Pln | |
| Chemat | 100mg | 558.80 Pln | |
| Chemat | 200mg | 803.60 Pln |
| delivery time | 3 weeks |
|---|
6,7-dimethoxy-N-(4-nitrophenyl)quinazolin-4-amine (CAS 765899-28-3) is a chemical compound with the molecular formula C16H14N4O4 and a molecular weight of 326.31 g/mol. IUPAC name: 6,7-dimethoxy-N-(4-nitrophenyl)quinazolin-4-amine. InChIKey: IJPROWBQSHRNDZ-UHFFFAOYSA-N.
| Molecular formula | C16H14N4O4 |
|---|---|
| Molecular weight | 326.31 g/mol |
| IUPAC name | 6,7-dimethoxy-N-(4-nitrophenyl)quinazolin-4-amine |
| InChIKey | IJPROWBQSHRNDZ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=NC=N2)NC3=CC=C(C=C3)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)