CAS 229476-52-2 is the registry number for 6,7-Dimethoxy-n-(2-nitrophenyl)quinazolin-4-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
6,7-dimethoxy-N-(2-nitrophenyl)quinazolin-4-amine (CAS 229476-52-2) is a chemical compound with the molecular formula C16H14N4O4 and a molecular weight of 326.31 g/mol. IUPAC name: 6,7-dimethoxy-N-(2-nitrophenyl)quinazolin-4-amine. InChIKey: DBRZNTSHNHLAPY-UHFFFAOYSA-N.
| Molecular formula | C16H14N4O4 |
|---|---|
| Molecular weight | 326.31 g/mol |
| IUPAC name | 6,7-dimethoxy-N-(2-nitrophenyl)quinazolin-4-amine |
| InChIKey | DBRZNTSHNHLAPY-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=NC=N2)NC3=CC=CC=C3[N+](=O)[O-])OC |
Computed by PubChem (NCBI)