cas: 153851-71-9 — see every product listed under this CAS number, including other names
6,7-dihydro-6-mercapto-5H-Pyrazolo[1,2-a][1,2,4]triazol-4-ium chloride 97% (CAS 153851-71-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A434196-1g |
| cas | 153851-71-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 192.38 Pln | |
| Ambeed | 5g | 665.19 Pln | |
| Ambeed | 10g | 1260.38 Pln | |
| Ambeed | 25g | 2189.31 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A434196 |
6,7-dihydro-5H-pyrazolo[1,2-a][1,2,4]triazol-4-ium-6-thiol chloride (CAS 153851-71-9) is a chemical compound with the molecular formula C5H8ClN3S and a molecular weight of 177.66 g/mol. IUPAC name: 6,7-dihydro-5H-pyrazolo[1,2-a][1,2,4]triazol-4-ium-6-thiol chloride. InChIKey: HPBXUFOSZBCEIQ-UHFFFAOYSA-N.
| Molecular formula | C5H8ClN3S |
|---|---|
| Molecular weight | 177.66 g/mol |
| IUPAC name | 6,7-dihydro-5H-pyrazolo[1,2-a][1,2,4]triazol-4-ium-6-thiol chloride |
| InChIKey | HPBXUFOSZBCEIQ-UHFFFAOYSA-N |
| SMILES | C1C(C[N+]2=CN=CN21)S.[Cl-] |
Computed by PubChem (NCBI)