cas: 18552-90-4 — see every product listed under this CAS number, including other names
6–Chloro–2–iodopurine (CAS 18552-90-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GD07349-100mg |
| cas | 18552-90-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 662.57 Pln | |
| GLPBio | 1g | 1528.46 Pln | |
| GLPBio | 250mg | 774.90 Pln | |
| GLPBio | 5g | 3943.60 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
6-chloro-2-iodo-7H-purine (CAS 18552-90-4) is a chemical compound with the molecular formula C5H2ClIN4 and a molecular weight of 280.45 g/mol. IUPAC name: 6-chloro-2-iodo-7H-purine. InChIKey: SZRNPDHDBPGZOA-UHFFFAOYSA-N.
| Molecular formula | C5H2ClIN4 |
|---|---|
| Molecular weight | 280.45 g/mol |
| IUPAC name | 6-chloro-2-iodo-7H-purine |
| InChIKey | SZRNPDHDBPGZOA-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(N1)C(=NC(=N2)I)Cl |
Computed by PubChem (NCBI)