CAS 18552-90-4 appears in our catalog under these names: 6-Chloro-2-iodo-7h-purine, 95%, 2-Iodo-6-chloropurine, 95%, 6–Chloro–2–iodopurine, 6-Chloro-2-iodopurine 95%, 6-Chloro-2-Iodopurine, 97%, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 25g, 100mg, 500mg.
6-chloro-2-iodo-7H-purine (CAS 18552-90-4) is a chemical compound with the molecular formula C5H2ClIN4 and a molecular weight of 280.45 g/mol. IUPAC name: 6-chloro-2-iodo-7H-purine. InChIKey: SZRNPDHDBPGZOA-UHFFFAOYSA-N.
| Molecular formula | C5H2ClIN4 |
|---|---|
| Molecular weight | 280.45 g/mol |
| IUPAC name | 6-chloro-2-iodo-7H-purine |
| InChIKey | SZRNPDHDBPGZOA-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(N1)C(=NC(=N2)I)Cl |
Computed by PubChem (NCBI)