cas: 55921-65-8 — see every product listed under this CAS number, including other names
6-(1-Pyrrolidinyl)-2,4-pyrimidinediamine 3-oxide, 97%, 97% (CAS 55921-65-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DE3L-1g |
| cas | 55921-65-8 |
| size | 1g |
| availability | 860g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 98.00 Pln | |
| Chemat | 10g | 117.20 Pln | |
| Chemat | 25g | 170.00 Pln | |
| Chemat | 50g | 256.40 Pln | |
| Chemat | 100g | 405.20 Pln | |
| Chemat | 250g | 750.80 Pln | |
| Chemat | 500g | 1372.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-hydroxy-2-imino-6-pyrrolidin-1-ylpyrimidin-4-amine (CAS 55921-65-8) is a chemical compound with the molecular formula C8H13N5O and a molecular weight of 195.22 g/mol. IUPAC name: 3-hydroxy-2-imino-6-pyrrolidin-1-ylpyrimidin-4-amine. InChIKey: JOITXEDSRYVTLJ-UHFFFAOYSA-N.
| Molecular formula | C8H13N5O |
|---|---|
| Molecular weight | 195.22 g/mol |
| IUPAC name | 3-hydroxy-2-imino-6-pyrrolidin-1-ylpyrimidin-4-amine |
| InChIKey | JOITXEDSRYVTLJ-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C2=NC(=N)N(C(=C2)N)O |
Computed by PubChem (NCBI)