CAS 1158775-43-9 is the registry number for 2-Amino-6-piperazin-1-ylpyrimidin-4(3h)-one dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-amino-4-piperazin-1-yl-1H-pyrimidin-6-one (CAS 1158775-43-9) is a chemical compound with the molecular formula C8H13N5O and a molecular weight of 195.22 g/mol. IUPAC name: 2-amino-4-piperazin-1-yl-1H-pyrimidin-6-one. InChIKey: NYEWZEPPLCRLNF-UHFFFAOYSA-N.
| Molecular formula | C8H13N5O |
|---|---|
| Molecular weight | 195.22 g/mol |
| IUPAC name | 2-amino-4-piperazin-1-yl-1H-pyrimidin-6-one |
| InChIKey | NYEWZEPPLCRLNF-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CC(=O)NC(=N2)N |
Computed by PubChem (NCBI)