cas: 171429-43-9 — see every product listed under this CAS number, including other names
6-(2,3,3-Trimethyl-3H-indol-1-ium-1-yl)hexanoate hydrobromide, 95% (CAS 171429-43-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F624406-50MG |
| cas | 171429-43-9 |
| size | 50mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 237.43 Pln | |
| Fluorochem | 100mg | 263.47 Pln | |
| Fluorochem | 250mg | 393.63 Pln | |
| Fluorochem | 1g | 523.79 Pln | |
| Fluorochem | 5g | 1403.69 Pln | |
| Fluorochem | 10g | 2715.73 Pln | |
| Fluorochem | 25g | 6266.56 Pln |
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
6-(2,3,3-trimethylindol-1-ium-1-yl)hexanoic acid bromide (CAS 171429-43-9) is a chemical compound with the molecular formula C17H24BrNO2 and a molecular weight of 354.3 g/mol. IUPAC name: 6-(2,3,3-trimethylindol-1-ium-1-yl)hexanoic acid bromide. InChIKey: YUUDHAOMIPLRQU-UHFFFAOYSA-N.
| Molecular formula | C17H24BrNO2 |
|---|---|
| Molecular weight | 354.3 g/mol |
| IUPAC name | 6-(2,3,3-trimethylindol-1-ium-1-yl)hexanoic acid bromide |
| InChIKey | YUUDHAOMIPLRQU-UHFFFAOYSA-N |
| SMILES | CC1=[N+](C2=CC=CC=C2C1(C)C)CCCCCC(=O)O.[Br-] |
Computed by PubChem (NCBI)