Products 2270906-01-7

CAS 2270906-01-7 is the registry number for [2-(4-Bromo-phenyl)-ethyl]-cyclobutyl-carbamic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Tert-butyl N-[2-(4-bromophenyl)ethyl]-N-cyclobutylcarbamate (CAS 2270906-01-7) is a chemical compound with the molecular formula C17H24BrNO2 and a molecular weight of 354.3 g/mol. IUPAC name: tert-butyl N-[2-(4-bromophenyl)ethyl]-N-cyclobutylcarbamate. InChIKey: VDTOBZGGIGTFKW-UHFFFAOYSA-N.

Identity
Molecular formulaC17H24BrNO2
Molecular weight354.3 g/mol
IUPAC nametert-butyl N-[2-(4-bromophenyl)ethyl]-N-cyclobutylcarbamate
InChIKeyVDTOBZGGIGTFKW-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N(CCC1=CC=C(C=C1)Br)C2CCC2

Computed by PubChem (NCBI)