cas: 1260091-04-0 — see every product listed under this CAS number, including other names
6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[d]oxazol-2-amine 98% (CAS 1260091-04-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A419393-250mg |
| cas | 1260091-04-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 353.69 Pln | |
| Ambeed | 1g | 832.06 Pln | |
| Ambeed | 5g | 3118.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A419393 |
6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazol-2-amine (CAS 1260091-04-0) is a chemical compound with the molecular formula C13H17BN2O3 and a molecular weight of 260.10 g/mol. IUPAC name: 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazol-2-amine. InChIKey: ASSAPUPXNGWQKH-UHFFFAOYSA-N.
| Molecular formula | C13H17BN2O3 |
|---|---|
| Molecular weight | 260.10 g/mol |
| IUPAC name | 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazol-2-amine |
| InChIKey | ASSAPUPXNGWQKH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)N=C(O3)N |
Computed by PubChem (NCBI)