Products 2377610-21-2
CAS 2377610-21-2 appears in our catalog under these names: 3-Aminobenzo[d]isoxazole-5-boronic acid pinacol ester, 96%, 5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzo(d)isoxazol-3-amine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-benzoxazol-3-amine (CAS 2377610-21-2) is a chemical compound with the molecular formula C13H17BN2O3 and a molecular weight of 260.10 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-benzoxazol-3-amine. InChIKey: UBLHDYAXBZFRPZ-UHFFFAOYSA-N.
| Molecular formula | C13H17BN2O3 |
|---|---|
| Molecular weight | 260.10 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-benzoxazol-3-amine |
| InChIKey | UBLHDYAXBZFRPZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)ON=C3N |
Computed by PubChem (NCBI)