cas: 2166-13-4 — see every product listed under this CAS number, including other names
6-(4-Chlorophenyl)-3(2H)pyridazinone, 95% (CAS 2166-13-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F042491-1G |
| cas | 2166-13-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 138.51 Pln | |
| Fluorochem | 5g | 310.33 Pln | |
| Fluorochem | 25g | 1169.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
3-(4-chlorophenyl)-1H-pyridazin-6-one (CAS 2166-13-4) is a chemical compound with the molecular formula C10H7ClN2O and a molecular weight of 206.63 g/mol. IUPAC name: 3-(4-chlorophenyl)-1H-pyridazin-6-one. InChIKey: HALBJPGFCUGLFM-UHFFFAOYSA-N.
| Molecular formula | C10H7ClN2O |
|---|---|
| Molecular weight | 206.63 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-1H-pyridazin-6-one |
| InChIKey | HALBJPGFCUGLFM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NNC(=O)C=C2)Cl |
Computed by PubChem (NCBI)