cas: 68360-22-5 — see every product listed under this CAS number, including other names
6-(Benzyloxy)-7-methoxy-3,4-dihydroisoquinoline, >97%, >97% (CAS 68360-22-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117579-100mg |
| cas | 68360-22-5 |
| size | 100mg |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 462.80 Pln | |
| Chemat | 250mg | 587.60 Pln | |
| Chemat | 1g | 1370.00 Pln | |
| Chemat | 5g | 2267.60 Pln | |
| Chemat | 10g | 3851.60 Pln | |
| Chemat | 25g | 8334.80 Pln |
| purity | >97% |
|---|---|
| delivery time | 3 weeks |
7-methoxy-6-phenylmethoxy-3,4-dihydroisoquinoline (CAS 68360-22-5) is a chemical compound with the molecular formula C17H17NO2 and a molecular weight of 267.32 g/mol. IUPAC name: 7-methoxy-6-phenylmethoxy-3,4-dihydroisoquinoline. InChIKey: ZIRDRQBTZSUXQD-UHFFFAOYSA-N.
| Molecular formula | C17H17NO2 |
|---|---|
| Molecular weight | 267.32 g/mol |
| IUPAC name | 7-methoxy-6-phenylmethoxy-3,4-dihydroisoquinoline |
| InChIKey | ZIRDRQBTZSUXQD-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2CCN=CC2=C1)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)