cas: 2764-59-2 — see every product listed under this CAS number, including other names
6-(Chloromethyl)quinoline hydrochloride 95% (CAS 2764-59-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A872650-100mg |
| cas | 2764-59-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 542.81 Pln | |
| Ambeed | 250mg | 871.00 Pln | |
| Ambeed | 1g | 2117.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A872650 |
6-(chloromethyl)quinoline;hydrochloride (CAS 2764-59-2) is a chemical compound with the molecular formula C10H9Cl2N and a molecular weight of 214.09 g/mol. IUPAC name: 6-(chloromethyl)quinoline;hydrochloride. InChIKey: SFSJEEURWPMFDR-UHFFFAOYSA-N.
| Molecular formula | C10H9Cl2N |
|---|---|
| Molecular weight | 214.09 g/mol |
| IUPAC name | 6-(chloromethyl)quinoline;hydrochloride |
| InChIKey | SFSJEEURWPMFDR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)CCl)N=C1.Cl |
Computed by PubChem (NCBI)