Products 2764-59-2
CAS 2764-59-2 appears in our catalog under these names: 6-(chloromethyl)quinoline hydrochloride, 95%, 6-(Chloromethyl)quinoline hydrochloride, 6-(Chloromethyl)quinoline hydrochloride 95%, 6-(Chloromethyl)quinoline hydrochloride, 95%, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 100mg, 5g, 2,5g.
6-(chloromethyl)quinoline;hydrochloride (CAS 2764-59-2) is a chemical compound with the molecular formula C10H9Cl2N and a molecular weight of 214.09 g/mol. IUPAC name: 6-(chloromethyl)quinoline;hydrochloride. InChIKey: SFSJEEURWPMFDR-UHFFFAOYSA-N.
| Molecular formula | C10H9Cl2N |
|---|---|
| Molecular weight | 214.09 g/mol |
| IUPAC name | 6-(chloromethyl)quinoline;hydrochloride |
| InChIKey | SFSJEEURWPMFDR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)CCl)N=C1.Cl |
Computed by PubChem (NCBI)