cas: 1160790-92-0 — see every product listed under this CAS number, including other names
6-(Morpholinomethyl)pyridine-3-boronic Acid Pinacol Ester, 98%, 98% (CAS 1160790-92-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111BKO-100mg |
| cas | 1160790-92-0 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 472.40 Pln | |
| Chemat | 250mg | 784.40 Pln | |
| Chemat | 1g | 1523.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]methyl]morpholine (CAS 1160790-92-0) is a chemical compound with the molecular formula C16H25BN2O3 and a molecular weight of 304.2 g/mol. IUPAC name: 4-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]methyl]morpholine. InChIKey: DDIPWDTXYFXZET-UHFFFAOYSA-N.
| Molecular formula | C16H25BN2O3 |
|---|---|
| Molecular weight | 304.2 g/mol |
| IUPAC name | 4-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]methyl]morpholine |
| InChIKey | DDIPWDTXYFXZET-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(C=C2)CN3CCOCC3 |
Computed by PubChem (NCBI)