cas: 1426082-97-4 — see every product listed under this CAS number, including other names
6-(Tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-2-carboxylic acid, 98%, 98% (CAS 1426082-97-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JJRI-100mg |
| cas | 1426082-97-4 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 203.60 Pln | |
| Chemat | 250mg | 290.00 Pln | |
| Chemat | 1g | 678.80 Pln | |
| Chemat | 5g | 2296.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-2-carboxylic acid (CAS 1426082-97-4) is a chemical compound with the molecular formula C17H19BO4 and a molecular weight of 298.1 g/mol. IUPAC name: 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-2-carboxylic acid. InChIKey: SAPDKZKVOAHAJU-UHFFFAOYSA-N.
| Molecular formula | C17H19BO4 |
|---|---|
| Molecular weight | 298.1 g/mol |
| IUPAC name | 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-2-carboxylic acid |
| InChIKey | SAPDKZKVOAHAJU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)C=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)