cas: 62620-71-7 — see every product listed under this CAS number, including other names
6-(Trifluoromethyl)-3,4-dihydronaphthalen-1(2H)-one, 95%, 95% (CAS 62620-71-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ELJE-100mg |
| cas | 62620-71-7 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 323.60 Pln | |
| Chemat | 250mg | 717.20 Pln | |
| Chemat | 1g | 1715.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
6-(trifluoromethyl)-3,4-dihydro-2H-naphthalen-1-one (CAS 62620-71-7) is a chemical compound with the molecular formula C11H9F3O and a molecular weight of 214.18 g/mol. IUPAC name: 6-(trifluoromethyl)-3,4-dihydro-2H-naphthalen-1-one. InChIKey: UHPCUZXSDJQOPS-UHFFFAOYSA-N.
| Molecular formula | C11H9F3O |
|---|---|
| Molecular weight | 214.18 g/mol |
| IUPAC name | 6-(trifluoromethyl)-3,4-dihydro-2H-naphthalen-1-one |
| InChIKey | UHPCUZXSDJQOPS-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)C(F)(F)F)C(=O)C1 |
Computed by PubChem (NCBI)