cas: 1082750-49-9 — see every product listed under this CAS number, including other names
6-(Trifluoromethyl)quinolin-3-amine 98% (CAS 1082750-49-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A405168-100mg |
| cas | 1082750-49-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 859.88 Pln | |
| Ambeed | 250mg | 1432.81 Pln | |
| Ambeed | 1g | 3507.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A405168 |
6-(trifluoromethyl)quinolin-3-amine (CAS 1082750-49-9) is a chemical compound with the molecular formula C10H7F3N2 and a molecular weight of 212.17 g/mol. IUPAC name: 6-(trifluoromethyl)quinolin-3-amine. InChIKey: BEYOSZHIAWYERF-UHFFFAOYSA-N.
| Molecular formula | C10H7F3N2 |
|---|---|
| Molecular weight | 212.17 g/mol |
| IUPAC name | 6-(trifluoromethyl)quinolin-3-amine |
| InChIKey | BEYOSZHIAWYERF-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=C(C=C2C=C1C(F)(F)F)N |
Computed by PubChem (NCBI)