cas: 17996-12-2 — see every product listed under this CAS number, including other names
6-(Z-Amino)-1-hexanol 97% (CAS 17996-12-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A184280-250mg |
| cas | 17996-12-2 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 164.56 Pln | |
| Ambeed | 25g | 275.81 Pln | |
| Ambeed | 100g | 698.56 Pln | |
| Ambeed | 500g | 2506.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A184280 |
Benzyl N-(6-hydroxyhexyl)carbamate (CAS 17996-12-2) is a chemical compound with the molecular formula C14H21NO3 and a molecular weight of 251.32 g/mol. IUPAC name: benzyl N-(6-hydroxyhexyl)carbamate. InChIKey: JMOQYRXPJQMWRQ-UHFFFAOYSA-N.
| Molecular formula | C14H21NO3 |
|---|---|
| Molecular weight | 251.32 g/mol |
| IUPAC name | benzyl N-(6-hydroxyhexyl)carbamate |
| InChIKey | JMOQYRXPJQMWRQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NCCCCCCO |
Computed by PubChem (NCBI)