cas: 17329-31-6 — see every product listed under this CAS number, including other names
6-Amino-3H-quinazolin-4-one, 98% (CAS 17329-31-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F059060-1G |
| cas | 17329-31-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 237.43 Pln | |
| Fluorochem | 5g | 903.87 Pln | |
| Fluorochem | 10g | 1601.54 Pln | |
| Fluorochem | 25g | 3090.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
6-amino-3H-quinazolin-4-one (CAS 17329-31-6) is a chemical compound with the molecular formula C8H7N3O and a molecular weight of 161.16 g/mol. IUPAC name: 6-amino-3H-quinazolin-4-one. InChIKey: MAIZCACENPZNCN-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | 6-amino-3H-quinazolin-4-one |
| InChIKey | MAIZCACENPZNCN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1N)C(=O)NC=N2 |
Computed by PubChem (NCBI)