CAS 50440-88-5 appears in our catalog under these names: 4-Aminoquinazolin-2-ol, 95%, 4-Aminoquinazolin-2-ol, 98%, 4-Aminoquinazolin-2-ol. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 10g, 5g, 250mg, 100mg.
4-amino-1H-quinazolin-2-one (CAS 50440-88-5) is a chemical compound with the molecular formula C8H7N3O and a molecular weight of 161.16 g/mol. IUPAC name: 4-amino-1H-quinazolin-2-one. InChIKey: NXBWFXMEJVOABP-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | 4-amino-1H-quinazolin-2-one |
| InChIKey | NXBWFXMEJVOABP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NC(=O)N2)N |
Computed by PubChem (NCBI)