CAS 20503-40-6 appears in our catalog under these names: 1,1-Dioxido-1-benzothien-6-ylamine, 6-Aminobenzo[b]thiophene 1,1-dioxide, Tech. , 6-Aminobenzo[b]thiophene 1,1-dioxide 97%, 6-Aminobenzo[b]thiophene 1,1-dioxide, 95%. Offered by: Biosynth, Thermo Scientific, Ambeed, Fluorochem. Available pack sizes: 2,5g, 250MG, 1g, 100mg, 5g, 10g.
1,1-dioxo-1-benzothiophen-6-amine (CAS 20503-40-6) is a chemical compound with the molecular formula C8H7NO2S and a molecular weight of 181.21 g/mol. IUPAC name: 1,1-dioxo-1-benzothiophen-6-amine. InChIKey: KRUCRVZSHWOMHC-UHFFFAOYSA-N.
| Molecular formula | C8H7NO2S |
|---|---|
| Molecular weight | 181.21 g/mol |
| IUPAC name | 1,1-dioxo-1-benzothiophen-6-amine |
| InChIKey | KRUCRVZSHWOMHC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C1C=CS2(=O)=O)N |
Computed by PubChem (NCBI)