cas: 1448-40-4 — see every product listed under this CAS number, including other names
6-Benzyl-2-methyl-5,6,7,8-tetrahydropyrido(4,3-d)pyrimidin-4-ol, 98% (CAS 1448-40-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A406523-5g |
| cas | 1448-40-4 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 9633.19 Pln | |
| AmBeed | 10g | 15218.77 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
6-benzyl-2-methyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (CAS 1448-40-4) is a chemical compound with the molecular formula C15H17N3O and a molecular weight of 255.31 g/mol. IUPAC name: 6-benzyl-2-methyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one. InChIKey: IGVWHXWXRQGWDW-UHFFFAOYSA-N.
| Molecular formula | C15H17N3O |
|---|---|
| Molecular weight | 255.31 g/mol |
| IUPAC name | 6-benzyl-2-methyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| InChIKey | IGVWHXWXRQGWDW-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(CN(CC2)CC3=CC=CC=C3)C(=O)N1 |
Computed by PubChem (NCBI)