cas: 1337523-99-5 — see every product listed under this CAS number, including other names
6-Bromo-1,2,3,4-tetrahydronaphthalen-1-amine, 96% (CAS 1337523-99-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F232648-100MG |
| cas | 1337523-99-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 279.09 Pln | |
| Fluorochem | 250mg | 409.25 Pln | |
| Fluorochem | 1g | 1013.20 Pln | |
| Fluorochem | 5g | 3850.75 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
6-bromo-1,2,3,4-tetrahydronaphthalen-1-amine (CAS 1337523-99-5) is a chemical compound with the molecular formula C10H12BrN and a molecular weight of 226.11 g/mol. IUPAC name: 6-bromo-1,2,3,4-tetrahydronaphthalen-1-amine. InChIKey: JBGXAYOORBASGV-UHFFFAOYSA-N.
| Molecular formula | C10H12BrN |
|---|---|
| Molecular weight | 226.11 g/mol |
| IUPAC name | 6-bromo-1,2,3,4-tetrahydronaphthalen-1-amine |
| InChIKey | JBGXAYOORBASGV-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C(C1)C=C(C=C2)Br)N |
Computed by PubChem (NCBI)