cas: 944709-63-1 — see every product listed under this CAS number, including other names
6-Bromo-2,3-dihydro-3-benzofuranamine, 98%, 98% (CAS 944709-63-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117ABT-100mg |
| cas | 944709-63-1 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 386.00 Pln | |
| Chemat | 250mg | 712.40 Pln | |
| Chemat | 1g | 1389.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
6-bromo-2,3-dihydro-1-benzofuran-3-amine (CAS 944709-63-1) is a chemical compound with the molecular formula C8H8BrNO and a molecular weight of 214.06 g/mol. IUPAC name: 6-bromo-2,3-dihydro-1-benzofuran-3-amine. InChIKey: VXHJNJHULJJTSD-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO |
|---|---|
| Molecular weight | 214.06 g/mol |
| IUPAC name | 6-bromo-2,3-dihydro-1-benzofuran-3-amine |
| InChIKey | VXHJNJHULJJTSD-UHFFFAOYSA-N |
| SMILES | C1C(C2=C(O1)C=C(C=C2)Br)N |
Computed by PubChem (NCBI)