cas: 944709-63-1 — see every product listed under this CAS number, including other names
6-Bromo-2,3-dihydrobenzofuran-3-amine 98% (CAS 944709-63-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A918276-100mg |
| cas | 944709-63-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 459.38 Pln | |
| Ambeed | 250mg | 815.38 Pln | |
| Ambeed | 1g | 1977.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A918276 |
6-bromo-2,3-dihydro-1-benzofuran-3-amine (CAS 944709-63-1) is a chemical compound with the molecular formula C8H8BrNO and a molecular weight of 214.06 g/mol. IUPAC name: 6-bromo-2,3-dihydro-1-benzofuran-3-amine. InChIKey: VXHJNJHULJJTSD-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO |
|---|---|
| Molecular weight | 214.06 g/mol |
| IUPAC name | 6-bromo-2,3-dihydro-1-benzofuran-3-amine |
| InChIKey | VXHJNJHULJJTSD-UHFFFAOYSA-N |
| SMILES | C1C(C2=C(O1)C=C(C=C2)Br)N |
Computed by PubChem (NCBI)