Products 1784619-01-7
CAS 1784619-01-7 appears in our catalog under these names: 6-BROMO-2,4-DICHLOROTHIENO[2,3-D]PYRIMIDINE, 98%, 6-Bromo-2,4-dichlorothieno[2,3-d]pyrimidine, 97%. Offered by: Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g.
6-bromo-2,4-dichlorothieno[2,3-d]pyrimidine (CAS 1784619-01-7) is a chemical compound with the molecular formula C6HBrCl2N2S and a molecular weight of 283.96 g/mol. IUPAC name: 6-bromo-2,4-dichlorothieno[2,3-d]pyrimidine. InChIKey: SZLGVKPPRDUDTI-UHFFFAOYSA-N.
| Molecular formula | C6HBrCl2N2S |
|---|---|
| Molecular weight | 283.96 g/mol |
| IUPAC name | 6-bromo-2,4-dichlorothieno[2,3-d]pyrimidine |
| InChIKey | SZLGVKPPRDUDTI-UHFFFAOYSA-N |
| SMILES | C1=C(SC2=C1C(=NC(=N2)Cl)Cl)Br |
Computed by PubChem (NCBI)