cas: 113092-96-9 — see every product listed under this CAS number, including other names
6-Bromo-2-chloro-3-methylquinoline 95% (CAS 113092-96-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A515177-100mg |
| cas | 113092-96-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 298.06 Pln | |
| Ambeed | 250mg | 375.94 Pln | |
| Ambeed | 1g | 620.69 Pln | |
| Ambeed | 5g | 2372.88 Pln | |
| Ambeed | 25g | 7317.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A515177 |
6-bromo-2-chloro-3-methylquinoline (CAS 113092-96-9) is a chemical compound with the molecular formula C10H7BrClN and a molecular weight of 256.52 g/mol. IUPAC name: 6-bromo-2-chloro-3-methylquinoline. InChIKey: VKGSTGZYRFTWNA-UHFFFAOYSA-N.
| Molecular formula | C10H7BrClN |
|---|---|
| Molecular weight | 256.52 g/mol |
| IUPAC name | 6-bromo-2-chloro-3-methylquinoline |
| InChIKey | VKGSTGZYRFTWNA-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=CC(=C2)Br)N=C1Cl |
Computed by PubChem (NCBI)