cas: 2413441-32-2 — see every product listed under this CAS number, including other names
6-Bromo-2-fluoro-3-isopropoxyphenol 98% (CAS 2413441-32-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1632145-250mg |
| cas | 2413441-32-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 353.69 Pln | |
| Ambeed | 1g | 843.19 Pln | |
| Ambeed | 5g | 2873.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1632145 |
6-bromo-2-fluoro-3-propan-2-yloxyphenol (CAS 2413441-32-2) is a chemical compound with the molecular formula C9H10BrFO2 and a molecular weight of 249.08 g/mol. IUPAC name: 6-bromo-2-fluoro-3-propan-2-yloxyphenol. InChIKey: JRZABWUPROZZPJ-UHFFFAOYSA-N.
| Molecular formula | C9H10BrFO2 |
|---|---|
| Molecular weight | 249.08 g/mol |
| IUPAC name | 6-bromo-2-fluoro-3-propan-2-yloxyphenol |
| InChIKey | JRZABWUPROZZPJ-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C(=C(C=C1)Br)O)F |
Computed by PubChem (NCBI)