cas: 2121514-68-7 — see every product listed under this CAS number, including other names
6-Bromo-2-fluoro-3-methylphenylboronic acid pinacol ester (CAS 2121514-68-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F627559-5G |
| cas | 2121514-68-7 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 1726.49 Pln | |
| Fluorochem | 10g | 2887.54 Pln |
| delivery time | 3-4 weeks |
|---|
2-(6-bromo-2-fluoro-3-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2121514-68-7) is a chemical compound with the molecular formula C13H17BBrFO2 and a molecular weight of 314.99 g/mol. IUPAC name: 2-(6-bromo-2-fluoro-3-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: ZRXDKPFQJIRQAH-UHFFFAOYSA-N.
| Molecular formula | C13H17BBrFO2 |
|---|---|
| Molecular weight | 314.99 g/mol |
| IUPAC name | 2-(6-bromo-2-fluoro-3-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | ZRXDKPFQJIRQAH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2F)C)Br |
Computed by PubChem (NCBI)