cas: 1160573-21-6 — see every product listed under this CAS number, including other names
6-Bromo-3-chloro-2,4-difluorobenzoic acid, 97%, 97% (CAS 1160573-21-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12F35L-250mg |
| cas | 1160573-21-6 |
| size | 250mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 194.00 Pln | |
| Chemat | 1g | 558.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
6-bromo-3-chloro-2,4-difluorobenzoic acid (CAS 1160573-21-6) is a chemical compound with the molecular formula C7H2BrClF2O2 and a molecular weight of 271.44 g/mol. IUPAC name: 6-bromo-3-chloro-2,4-difluorobenzoic acid. InChIKey: PZXNBLOHRJNZFP-UHFFFAOYSA-N.
| Molecular formula | C7H2BrClF2O2 |
|---|---|
| Molecular weight | 271.44 g/mol |
| IUPAC name | 6-bromo-3-chloro-2,4-difluorobenzoic acid |
| InChIKey | PZXNBLOHRJNZFP-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)C(=O)O)F)Cl)F |
Computed by PubChem (NCBI)